Properties
- Name: Tris(4-cyanophenyl)methane
- IUPAC name: Tris(4-cyanophenyl)methane
- Formula: C22H13N3
- Molecular weight: 319.3587 g/mol
- Monoisotopic weight: 319.1109474 g/mol
Structure
InChI
InChI=1/C22H13N3/c23-13-16-1-7-19(8-2-16)22(20-9-3-17(14-24)4-10-20)21-11-5-18(15-25)6-12-21/h1-12,22H
