Properties
- Name: Porphin
- IUPAC name: Porphyrin
- Formula: C20H14N4
- Molecular weight: 310.3520 g/mol
- Monoisotopic weight: 310.1218465 g/mol
Structure
InChI
InChI=1/C20H14N4/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14/h1-12,21,24H/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-1
2-
