Properties
- Name: Hexadecahydro-1H-cyclopenta[a]phenanthrene
- IUPAC name: 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-Hexadecahydro-1H-cyclopenta[a]phenanthrene
- Formula: C17H28
- Molecular weight: 232.4042 g/mol
- Monoisotopic weight: 232.2191009 g/mol
Structure
InChI
InChI=1/C17H28/c1-2-6-14-12(4-1)8-10-17-15-7-3-5-13(15)9-11-16(14)17/h12-17H,1-11H2/t12-,13-,14+,15+,16+,17-/m0/s1
